C26H34N2O6 — CID 154353772
[2-(benzylamino)acetyl] (2S)-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(2-methoxyphenyl)propanoate (PubChem CID 154353772) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is [2-(benzylamino)acetyl] (2S)-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(2-methoxyphenyl)propanoate.
| Compound Name | [2-(benzylamino)acetyl] (2S)-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(2-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 154353772 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | [2-(benzylamino)acetyl] (2S)-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(2-methoxyphenyl)propanoate |
| SMILES | CCN(C(=O)OC(C)(C)C)[C@@H](Cc1ccccc1OC)C(=O)OC(=O)CNCc1ccccc1 |
| InChI | InChI=1S/C26H34N2O6/c1-6-28(25(31)34-26(2,3)4)21(16-20-14-10-11-15-22(20)32-5)24(30)33-23(29)18-27-17-19-12-8-7-9-13-19/h7-15,21,27H,6,16-18H2,1-5H3/t21-/m0/s1 |
| InChIKey | ZUGGGFRYVYXXKO-NRFANRHFSA-N |
| XLogP | 3.72 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|