C25H32N2O6 — CID 154363417
[2-(benzylamino)acetyl] (2R)-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 154363417) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is [2-(benzylamino)acetyl] (2R)-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | [2-(benzylamino)acetyl] (2R)-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 154363417 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | [2-(benzylamino)acetyl] (2R)-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | CCN(C(=O)OC(C)(C)C)[C@H](Cc1ccc(O)cc1)C(=O)OC(=O)CNCc1ccccc1 |
| InChI | InChI=1S/C25H32N2O6/c1-5-27(24(31)33-25(2,3)4)21(15-18-11-13-20(28)14-12-18)23(30)32-22(29)17-26-16-19-9-7-6-8-10-19/h6-14,21,26,28H,5,15-17H2,1-4H3/t21-/m1/s1 |
| InChIKey | BHORRRWDAYXVTM-OAQYLSRUSA-N |
| XLogP | 3.42 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|