C21H21Cl2N5 — CID 15435628
4-(4-benzylpiperidin-1-yl)-6-(2,5-dichlorophenyl)-1,3,5-triazin-2-amine (PubChem CID 15435628) has the molecular formula C21H21Cl2N5 and a molecular weight of 414.34 g/mol. Its IUPAC name is 4-(4-benzylpiperidin-1-yl)-6-(2,5-dichlorophenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(4-benzylpiperidin-1-yl)-6-(2,5-dichlorophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 15435628 |
| Molecular Formula | C21H21Cl2N5 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-(4-benzylpiperidin-1-yl)-6-(2,5-dichlorophenyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(-c2cc(Cl)ccc2Cl)nc(N2CCC(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C21H21Cl2N5/c22-16-6-7-18(23)17(13-16)19-25-20(24)27-21(26-19)28-10-8-15(9-11-28)12-14-4-2-1-3-5-14/h1-7,13,15H,8-12H2,(H2,24,25,26,27) |
| InChIKey | XOUKNSBVTOEDBZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |