C18H15NO5S — CID 154356336
2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenoxy]phenyl]acetic acid (PubChem CID 154356336) has the molecular formula C18H15NO5S and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 154356336 |
| Molecular Formula | C18H15NO5S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-[4-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(Oc2ccc(CN3C(=O)CSC3=O)cc2)cc1 |
| InChI | InChI=1S/C18H15NO5S/c20-16-11-25-18(23)19(16)10-13-3-7-15(8-4-13)24-14-5-1-12(2-6-14)9-17(21)22/h1-8H,9-11H2,(H,21,22) |
| InChIKey | GORDMXWENJFHHQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|