C12H18Si — CID 15436146
1,1-dimethyl-1-silacycloundeca-3,9-diyne (PubChem CID 15436146) has the molecular formula C12H18Si and a molecular weight of 190.36 g/mol. Its IUPAC name is 1,1-dimethyl-1-silacycloundeca-3,9-diyne.
| Compound Name | 1,1-dimethyl-1-silacycloundeca-3,9-diyne |
|---|---|
| PubChem CID | 15436146 |
| Molecular Formula | C12H18Si |
| Molecular Weight | 190.36 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1,1-dimethyl-1-silacycloundeca-3,9-diyne |
| SMILES | C[Si]1(C)CC#CCCCCC#CC1 |
| InChI | InChI=1S/C12H18Si/c1-13(2)11-9-7-5-3-4-6-8-10-12-13/h3-6,11-12H2,1-2H3 |
| InChIKey | IJXNCBZUMGFKIJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|