About 2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide
2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide (PubChem CID 154365304) has the molecular formula C21H30N4OS
and a molecular weight of 386.57 g/mol. Its IUPAC name is 2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide.
Molecular Properties
| Compound Name | 2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide |
| PubChem CID | 154365304 |
| Molecular Formula | C21H30N4OS |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide |
| SMILES | NC(=O)CC1CCC(CCN2CCN(c3nccc4ccsc34)CC2)CC1 |
| InChI | InChI=1S/C21H30N4OS/c22-19(26)15-17-3-1-16(2-4-17)6-9-24-10-12-25(13-11-24)21-20-18(5-8-23-21)7-14-27-20/h5,7-8,14,16-17H,1-4,6,9-13,15H2,(H2,22,26) |
| InChIKey | WSRLAEVWTCBRDF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide?
The IUPAC name of 2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide (CID 154365304) is 2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide.
What is the SMILES notation for 2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide?
The canonical SMILES for 2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide is NC(=O)CC1CCC(CCN2CCN(c3nccc4ccsc34)CC2)CC1.
What is the InChIKey of 2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide?
The InChIKey is WSRLAEVWTCBRDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N4OS/c22-19(26)15-17-3-1-16(2-4-17)6-9-24-10-12-25(13-11-24)21-20-18(5-8-23-21)7-14-27-20/h5,7-8,14,16-17H,1-4,6,9-13,15H2,(H2,22,26).
What are the key properties of 2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide?
2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide has a molecular weight of 386.57 g/mol, XLogP of 3.49, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(4-thieno[2,3-c]pyridin-7-ylpiperazin-1-yl)ethyl]cyclohexyl]acetamide is sourced from PubChem (CID 154365304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).