C21H29N3O2S — CID 170434119
[4-[2-[4-(1-benzothiophen-7-yl)piperazin-1-yl]ethyl]cyclohexyl]carbamic acid (PubChem CID 170434119) has the molecular formula C21H29N3O2S and a molecular weight of 387.55 g/mol. Its IUPAC name is [4-[2-[4-(1-benzothiophen-7-yl)piperazin-1-yl]ethyl]cyclohexyl]carbamic acid.
| Compound Name | [4-[2-[4-(1-benzothiophen-7-yl)piperazin-1-yl]ethyl]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 170434119 |
| Molecular Formula | C21H29N3O2S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | [4-[2-[4-(1-benzothiophen-7-yl)piperazin-1-yl]ethyl]cyclohexyl]carbamic acid |
| SMILES | O=C(O)NC1CCC(CCN2CCN(c3cccc4ccsc34)CC2)CC1 |
| InChI | InChI=1S/C21H29N3O2S/c25-21(26)22-18-6-4-16(5-7-18)8-10-23-11-13-24(14-12-23)19-3-1-2-17-9-15-27-20(17)19/h1-3,9,15-16,18,22H,4-8,10-14H2,(H,25,26) |
| InChIKey | AVSKAHBNSXFDJS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |