C29H24F6N2O2 — CID 154365933
3-[2-[(3-aminophenyl)-phenoxymethyl]-3,3,3-trifluoro-1-phenoxy-2-(trifluoromethyl)propyl]aniline (PubChem CID 154365933) has the molecular formula C29H24F6N2O2 and a molecular weight of 546.51 g/mol. Its IUPAC name is 3-[2-[(3-aminophenyl)-phenoxymethyl]-3,3,3-trifluoro-1-phenoxy-2-(trifluoromethyl)propyl]aniline.
| Compound Name | 3-[2-[(3-aminophenyl)-phenoxymethyl]-3,3,3-trifluoro-1-phenoxy-2-(trifluoromethyl)propyl]aniline |
|---|---|
| PubChem CID | 154365933 |
| Molecular Formula | C29H24F6N2O2 |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 3-[2-[(3-aminophenyl)-phenoxymethyl]-3,3,3-trifluoro-1-phenoxy-2-(trifluoromethyl)propyl]aniline |
| SMILES | Nc1cccc(C(Oc2ccccc2)C(C(Oc2ccccc2)c2cccc(N)c2)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C29H24F6N2O2/c30-28(31,32)27(29(33,34)35,25(19-9-7-11-21(36)17-19)38-23-13-3-1-4-14-23)26(20-10-8-12-22(37)18-20)39-24-15-5-2-6-16-24/h1-18,25-26H,36-37H2 |
| InChIKey | JSGSRLXOBFLZRQ-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|