C14H12N2 — CID 154370356
5-phenyl-1H-indol-2-amine (PubChem CID 154370356) has the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 5-phenyl-1H-indol-2-amine.
| Compound Name | 5-phenyl-1H-indol-2-amine |
|---|---|
| PubChem CID | 154370356 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 5-phenyl-1H-indol-2-amine |
| SMILES | Nc1cc2cc(-c3ccccc3)ccc2[nH]1 |
| InChI | InChI=1S/C14H12N2/c15-14-9-12-8-11(6-7-13(12)16-14)10-4-2-1-3-5-10/h1-9,16H,15H2 |
| InChIKey | GVGDKDDHSPZIHC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |