C11H16F5O2S- — CID 154371919
2-(4,4,5,5,5-pentafluoropentylsulfanyl)hexanoate (PubChem CID 154371919) has the molecular formula C11H16F5O2S- and a molecular weight of 307.30 g/mol. Its IUPAC name is 2-(4,4,5,5,5-pentafluoropentylsulfanyl)hexanoate.
| Compound Name | 2-(4,4,5,5,5-pentafluoropentylsulfanyl)hexanoate |
|---|---|
| PubChem CID | 154371919 |
| Molecular Formula | C11H16F5O2S- |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-(4,4,5,5,5-pentafluoropentylsulfanyl)hexanoate |
| SMILES | CCCCC(SCCCC(F)(F)C(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C11H17F5O2S/c1-2-3-5-8(9(17)18)19-7-4-6-10(12,13)11(14,15)16/h8H,2-7H2,1H3,(H,17,18)/p-1 |
| InChIKey | SZYVWFWOBDUMMY-UHFFFAOYSA-M |
| XLogP | 3.01 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|