C14H15NO3S — CID 15437500
3-(benzenesulfonyl)-2-ethenyloxane-3-carbonitrile (PubChem CID 15437500) has the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2-ethenyloxane-3-carbonitrile.
| Compound Name | 3-(benzenesulfonyl)-2-ethenyloxane-3-carbonitrile |
|---|---|
| PubChem CID | 15437500 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 3-(benzenesulfonyl)-2-ethenyloxane-3-carbonitrile |
| SMILES | C=CC1OCCCC1(C#N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H15NO3S/c1-2-13-14(11-15,9-6-10-18-13)19(16,17)12-7-4-3-5-8-12/h2-5,7-8,13H,1,6,9-10H2 |
| InChIKey | KDDVPHMEFWHBCB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|