C17H12ClF4NO2 — CID 15438203
ethyl 1-(2-chloro-1,1,2,2-tetrafluoroethyl)pyrrolo[2,1-a]isoquinoline-3-carboxylate (PubChem CID 15438203) has the molecular formula C17H12ClF4NO2 and a molecular weight of 373.73 g/mol. Its IUPAC name is ethyl 1-(2-chloro-1,1,2,2-tetrafluoroethyl)pyrrolo[2,1-a]isoquinoline-3-carboxylate.
| Compound Name | ethyl 1-(2-chloro-1,1,2,2-tetrafluoroethyl)pyrrolo[2,1-a]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 15438203 |
| Molecular Formula | C17H12ClF4NO2 |
| Molecular Weight | 373.73 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | ethyl 1-(2-chloro-1,1,2,2-tetrafluoroethyl)pyrrolo[2,1-a]isoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(F)(F)C(F)(F)Cl)c2c3ccccc3ccn12 |
| InChI | InChI=1S/C17H12ClF4NO2/c1-2-25-15(24)13-9-12(16(19,20)17(18,21)22)14-11-6-4-3-5-10(11)7-8-23(13)14/h3-9H,2H2,1H3 |
| InChIKey | ZKLCVYQUZKLBKD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.73 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|