C18H18N6S — CID 154385627
2-benzyl-4-(1-benzyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione (PubChem CID 154385627) has the molecular formula C18H18N6S and a molecular weight of 350.45 g/mol. Its IUPAC name is 2-benzyl-4-(1-benzyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione.
| Compound Name | 2-benzyl-4-(1-benzyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione |
|---|---|
| PubChem CID | 154385627 |
| Molecular Formula | C18H18N6S |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-benzyl-4-(1-benzyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione |
| SMILES | S=c1c(C2=NNNN2Cc2ccccc2)c[nH]n1Cc1ccccc1 |
| InChI | InChI=1S/C18H18N6S/c25-18-16(11-19-24(18)13-15-9-5-2-6-10-15)17-20-21-22-23(17)12-14-7-3-1-4-8-14/h1-11,19,21-22H,12-13H2 |
| InChIKey | BCQBNLNABBEPIE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|