C12H14N6S — CID 90028976
4-(1-benzyl-2,3-dihydrotetrazol-5-yl)-2-methyl-1H-pyrazole-3-thione (PubChem CID 90028976) has the molecular formula C12H14N6S and a molecular weight of 274.35 g/mol. Its IUPAC name is 4-(1-benzyl-2,3-dihydrotetrazol-5-yl)-2-methyl-1H-pyrazole-3-thione.
| Compound Name | 4-(1-benzyl-2,3-dihydrotetrazol-5-yl)-2-methyl-1H-pyrazole-3-thione |
|---|---|
| PubChem CID | 90028976 |
| Molecular Formula | C12H14N6S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-(1-benzyl-2,3-dihydrotetrazol-5-yl)-2-methyl-1H-pyrazole-3-thione |
| SMILES | Cn1[nH]cc(C2=NNNN2Cc2ccccc2)c1=S |
| InChI | InChI=1S/C12H14N6S/c1-17-12(19)10(7-13-17)11-14-15-16-18(11)8-9-5-3-2-4-6-9/h2-7,13,15-16H,8H2,1H3 |
| InChIKey | UDEWWSZTBVBPKL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 60.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|