C14H16N4O3 — CID 154390949
methyl 3-oxo-4-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)piperazine-2-carboxylate (PubChem CID 154390949) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is methyl 3-oxo-4-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)piperazine-2-carboxylate.
| Compound Name | methyl 3-oxo-4-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 154390949 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | methyl 3-oxo-4-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)piperazine-2-carboxylate |
| SMILES | COC(=O)C1NCCN(Cc2cc3cnccc3[nH]2)C1=O |
| InChI | InChI=1S/C14H16N4O3/c1-21-14(20)12-13(19)18(5-4-16-12)8-10-6-9-7-15-3-2-11(9)17-10/h2-3,6-7,12,16-17H,4-5,8H2,1H3 |
| InChIKey | YYHDRNVWOYEIDI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|