C19H19BrN4OS — CID 139904197
(E)-3-(4-bromothiophen-2-yl)-1-[4-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 139904197) has the molecular formula C19H19BrN4OS and a molecular weight of 431.36 g/mol. Its IUPAC name is (E)-3-(4-bromothiophen-2-yl)-1-[4-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-bromothiophen-2-yl)-1-[4-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139904197 |
| Molecular Formula | C19H19BrN4OS |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | (E)-3-(4-bromothiophen-2-yl)-1-[4-(1H-pyrrolo[3,2-c]pyridin-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(Br)cs1)N1CCN(Cc2cc3cnccc3[nH]2)CC1 |
| InChI | InChI=1S/C19H19BrN4OS/c20-15-10-17(26-13-15)1-2-19(25)24-7-5-23(6-8-24)12-16-9-14-11-21-4-3-18(14)22-16/h1-4,9-11,13,22H,5-8,12H2/b2-1+ |
| InChIKey | AZIHMTLTNRUCIE-OWOJBTEDSA-N |
| XLogP | 3.74 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|