C15H17N5OS — CID 154395757
1-(6-cyano-1,3-benzothiazol-2-yl)-1-(piperidin-4-ylmethyl)urea (PubChem CID 154395757) has the molecular formula C15H17N5OS and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-(6-cyano-1,3-benzothiazol-2-yl)-1-(piperidin-4-ylmethyl)urea.
| Compound Name | 1-(6-cyano-1,3-benzothiazol-2-yl)-1-(piperidin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 154395757 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-(6-cyano-1,3-benzothiazol-2-yl)-1-(piperidin-4-ylmethyl)urea |
| SMILES | N#Cc1ccc2nc(N(CC3CCNCC3)C(N)=O)sc2c1 |
| InChI | InChI=1S/C15H17N5OS/c16-8-11-1-2-12-13(7-11)22-15(19-12)20(14(17)21)9-10-3-5-18-6-4-10/h1-2,7,10,18H,3-6,9H2,(H2,17,21) |
| InChIKey | DEABVFUHODDUPM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |