C9H10O2S — CID 154402079
1-thiophen-2-ylpentane-2,4-dione (PubChem CID 154402079) has the molecular formula C9H10O2S and a molecular weight of 182.24 g/mol. Its IUPAC name is 1-thiophen-2-ylpentane-2,4-dione.
| Compound Name | 1-thiophen-2-ylpentane-2,4-dione |
|---|---|
| PubChem CID | 154402079 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 1-thiophen-2-ylpentane-2,4-dione |
| SMILES | CC(=O)CC(=O)Cc1cccs1 |
| InChI | InChI=1S/C9H10O2S/c1-7(10)5-8(11)6-9-3-2-4-12-9/h2-4H,5-6H2,1H3 |
| InChIKey | XIPQDFNTUVOBCN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|