C10H12O2S — CID 86201838
1-thiophen-2-ylhexane-2,4-dione (PubChem CID 86201838) has the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-thiophen-2-ylhexane-2,4-dione.
| Compound Name | 1-thiophen-2-ylhexane-2,4-dione |
|---|---|
| PubChem CID | 86201838 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 1-thiophen-2-ylhexane-2,4-dione |
| SMILES | CCC(=O)CC(=O)Cc1cccs1 |
| InChI | InChI=1S/C10H12O2S/c1-2-8(11)6-9(12)7-10-4-3-5-13-10/h3-5H,2,6-7H2,1H3 |
| InChIKey | NRJBZXWZOFEQLM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|