About cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid
cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid (PubChem CID 175235055) has the molecular formula C14H21F3O4S2
and a molecular weight of 374.45 g/mol. Its IUPAC name is cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid |
| PubChem CID | 175235055 |
| Molecular Formula | C14H21F3O4S2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid |
| SMILES | C1CCCC1.CCC(=O)Cc1cccs1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C8H10OS.C5H10.CHF3O3S/c1-2-7(9)6-8-4-3-5-10-8;1-2-4-5-3-1;2-1(3,4)8(5,6)7/h3-5H,2,6H2,1H3;1-5H2;(H,5,6,7) |
| InChIKey | KHMWZFUVLSNXNY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid?
The IUPAC name of cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid (CID 175235055) is cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid.
What is the SMILES notation for cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid?
The canonical SMILES for cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid is C1CCCC1.CCC(=O)Cc1cccs1.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid?
The InChIKey is KHMWZFUVLSNXNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10OS.C5H10.CHF3O3S/c1-2-7(9)6-8-4-3-5-10-8;1-2-4-5-3-1;2-1(3,4)8(5,6)7/h3-5H,2,6H2,1H3;1-5H2;(H,5,6,7).
What are the key properties of cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid?
cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid has a molecular weight of 374.45 g/mol, XLogP of 4.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;1-thiophen-2-ylbutan-2-one;trifluoromethanesulfonic acid is sourced from PubChem (CID 175235055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).