C20H18ClNOS — CID 15440331
(4aS,5R,10bS)-5-(3-chloro-1-benzothiophen-2-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 15440331) has the molecular formula C20H18ClNOS and a molecular weight of 355.89 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-(3-chloro-1-benzothiophen-2-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-5-(3-chloro-1-benzothiophen-2-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 15440331 |
| Molecular Formula | C20H18ClNOS |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (4aS,5R,10bS)-5-(3-chloro-1-benzothiophen-2-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | Clc1c([C@@H]2Nc3ccccc3[C@H]3OCCC[C@H]32)sc2ccccc12 |
| InChI | InChI=1S/C20H18ClNOS/c21-17-13-7-2-4-10-16(13)24-20(17)18-14-8-5-11-23-19(14)12-6-1-3-9-15(12)22-18/h1-4,6-7,9-10,14,18-19,22H,5,8,11H2/t14-,18+,19+/m0/s1 |
| InChIKey | ZRSSLXLOIOOAIE-GDIGMMSISA-N |
| XLogP | 6.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |