C22H21NO — CID 23729559
(4aS,5R,10bS)-5-naphthalen-1-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 23729559) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-naphthalen-1-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-5-naphthalen-1-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 23729559 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (4aS,5R,10bS)-5-naphthalen-1-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | c1ccc2c(c1)N[C@@H](c1cccc3ccccc13)[C@@H]1CCCO[C@H]21 |
| InChI | InChI=1S/C22H21NO/c1-2-9-16-15(7-1)8-5-11-17(16)21-19-12-6-14-24-22(19)18-10-3-4-13-20(18)23-21/h1-5,7-11,13,19,21-23H,6,12,14H2/t19-,21-,22+/m0/s1 |
| InChIKey | ALKUXGOXAUZUGW-ILWGZMRPSA-N |
| XLogP | 5.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |