C31H51N3O4SSi2 — CID 154404443
5-[4-[[(1R,3R,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-tri(propan-2-yl)silyloxycyclopentyl]amino]pyrimidine-5-carbonyl]thiophene-3-carbaldehyde (PubChem CID 154404443) has the molecular formula C31H51N3O4SSi2 and a molecular weight of 618.01 g/mol. Its IUPAC name is 5-[4-[[(1R,3R,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-tri(propan-2-yl)silyloxycyclopentyl]amino]pyrimidine-5-carbonyl]thiophene-3-carbaldehyde.
| Compound Name | 5-[4-[[(1R,3R,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-tri(propan-2-yl)silyloxycyclopentyl]amino]pyrimidine-5-carbonyl]thiophene-3-carbaldehyde |
|---|---|
| PubChem CID | 154404443 |
| Molecular Formula | C31H51N3O4SSi2 |
| Molecular Weight | 618.01 g/mol |
| Exact Mass | 617.31 |
| IUPAC Name | 5-[4-[[(1R,3R,4S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-tri(propan-2-yl)silyloxycyclopentyl]amino]pyrimidine-5-carbonyl]thiophene-3-carbaldehyde |
| SMILES | CC(C)[Si](O[C@H]1C[C@H](Nc2ncncc2C(=O)c2cc(C=O)cs2)C[C@@H]1CO[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H51N3O4SSi2/c1-20(2)41(21(3)4,22(5)6)38-27-14-25(13-24(27)17-37-40(10,11)31(7,8)9)34-30-26(15-32-19-33-30)29(36)28-12-23(16-35)18-39-28/h12,15-16,18-22,24-25,27H,13-14,17H2,1-11H3,(H,32,33,34)/t24-,25-,27+/m1/s1 |
| InChIKey | SAVKTNGZVLDXPI-SLQPCKNISA-N |
| XLogP | 8.35 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.01 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|