C23H37N5O3Si — CID 140753782
[4-[[(1R,3R,4S)-3-(hydroxymethyl)-4-tri(propan-2-yl)silyloxycyclopentyl]amino]pyrimidin-5-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 140753782) has the molecular formula C23H37N5O3Si and a molecular weight of 459.67 g/mol. Its IUPAC name is [4-[[(1R,3R,4S)-3-(hydroxymethyl)-4-tri(propan-2-yl)silyloxycyclopentyl]amino]pyrimidin-5-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [4-[[(1R,3R,4S)-3-(hydroxymethyl)-4-tri(propan-2-yl)silyloxycyclopentyl]amino]pyrimidin-5-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 140753782 |
| Molecular Formula | C23H37N5O3Si |
| Molecular Weight | 459.67 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | [4-[[(1R,3R,4S)-3-(hydroxymethyl)-4-tri(propan-2-yl)silyloxycyclopentyl]amino]pyrimidin-5-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | CC(C)[Si](O[C@H]1C[C@H](Nc2ncncc2C(=O)c2ccn[nH]2)C[C@@H]1CO)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H37N5O3Si/c1-14(2)32(15(3)4,16(5)6)31-21-10-18(9-17(21)12-29)27-23-19(11-24-13-25-23)22(30)20-7-8-26-28-20/h7-8,11,13-18,21,29H,9-10,12H2,1-6H3,(H,26,28)(H,24,25,27)/t17-,18-,21+/m1/s1 |
| InChIKey | JWZOQRMCPRQJTJ-OPYAIIAOSA-N |
| XLogP | 4.17 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.67 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|