C23H35N5O4Si — CID 140753718
[4-[[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]amino]pyrimidin-5-yl]-(1H-pyrazol-5-yl)methanone (PubChem CID 140753718) has the molecular formula C23H35N5O4Si and a molecular weight of 473.65 g/mol. Its IUPAC name is [4-[[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]amino]pyrimidin-5-yl]-(1H-pyrazol-5-yl)methanone.
| Compound Name | [4-[[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]amino]pyrimidin-5-yl]-(1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 140753718 |
| Molecular Formula | C23H35N5O4Si |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | [4-[[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]amino]pyrimidin-5-yl]-(1H-pyrazol-5-yl)methanone |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)C[C@@H](Nc3ncncc3C(=O)c3ccn[nH]3)[C@@H]2O1 |
| InChI | InChI=1S/C23H35N5O4Si/c1-22(2,3)33(6,7)30-12-14-10-17(20-19(14)31-23(4,5)32-20)27-21-15(11-24-13-25-21)18(29)16-8-9-26-28-16/h8-9,11,13-14,17,19-20H,10,12H2,1-7H3,(H,26,28)(H,24,25,27)/t14-,17-,19-,20+/m1/s1 |
| InChIKey | GPQSXLYJYZQORQ-JRJVTICQSA-N |
| XLogP | 3.77 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|