C14H17NO6S — CID 15441022
1-O-ethyl 4-O-methyl (2R,3S)-3-methyl-2-(4-nitrophenyl)sulfanylbutanedioate (PubChem CID 15441022) has the molecular formula C14H17NO6S and a molecular weight of 327.36 g/mol. Its IUPAC name is 1-O-ethyl 4-O-methyl (2R,3S)-3-methyl-2-(4-nitrophenyl)sulfanylbutanedioate.
| Compound Name | 1-O-ethyl 4-O-methyl (2R,3S)-3-methyl-2-(4-nitrophenyl)sulfanylbutanedioate |
|---|---|
| PubChem CID | 15441022 |
| Molecular Formula | C14H17NO6S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 1-O-ethyl 4-O-methyl (2R,3S)-3-methyl-2-(4-nitrophenyl)sulfanylbutanedioate |
| SMILES | CCOC(=O)[C@H](Sc1ccc([N+](=O)[O-])cc1)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C14H17NO6S/c1-4-21-14(17)12(9(2)13(16)20-3)22-11-7-5-10(6-8-11)15(18)19/h5-9,12H,4H2,1-3H3/t9-,12-/m1/s1 |
| InChIKey | UFXCVJKSZOWZEL-BXKDBHETSA-N |
| XLogP | 2.43 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|