About azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate
azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate (PubChem CID 159222210) has the molecular formula C14H26N2O4S
and a molecular weight of 318.44 g/mol. Its IUPAC name is azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate.
Molecular Properties
| Compound Name | azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate |
| PubChem CID | 159222210 |
| Molecular Formula | C14H26N2O4S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate |
| SMILES | C.C.CCCC(Sc1ccc([N+](=O)[O-])cc1)C(=O)OC.N |
| InChI | InChI=1S/C12H15NO4S.2CH4.H3N/c1-3-4-11(12(14)17-2)18-10-7-5-9(6-8-10)13(15)16;;;/h5-8,11H,3-4H2,1-2H3;2*1H4;1H3 |
| InChIKey | OWZSGSDADHJRFY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate?
The IUPAC name of azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate (CID 159222210) is azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate.
What is the SMILES notation for azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate?
The canonical SMILES for azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate is C.C.CCCC(Sc1ccc([N+](=O)[O-])cc1)C(=O)OC.N.
What is the InChIKey of azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate?
The InChIKey is OWZSGSDADHJRFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4S.2CH4.H3N/c1-3-4-11(12(14)17-2)18-10-7-5-9(6-8-10)13(15)16;;;/h5-8,11H,3-4H2,1-2H3;2*1H4;1H3.
What are the key properties of azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate?
azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate has a molecular weight of 318.44 g/mol, XLogP of 4.46, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;methane;methyl 2-(4-nitrophenyl)sulfanylpentanoate is sourced from PubChem (CID 159222210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).