About 4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate
4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate (PubChem CID 134936177) has the molecular formula C13H14N2O6S
and a molecular weight of 326.33 g/mol. Its IUPAC name is 4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate.
Molecular Properties
| Compound Name | 4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate |
| PubChem CID | 134936177 |
| Molecular Formula | C13H14N2O6S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate |
| SMILES | CCOC(=O)C/C(=N\Sc1ccc([N+](=O)[O-])cc1)C(=O)OC |
| InChI | InChI=1S/C13H14N2O6S/c1-3-21-12(16)8-11(13(17)20-2)14-22-10-6-4-9(5-7-10)15(18)19/h4-7H,3,8H2,1-2H3/b14-11+ |
| InChIKey | JCAREHFLONDKBE-SDNWHVSQSA-N |
| XLogP | 2.17 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate?
The IUPAC name of 4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate (CID 134936177) is 4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate.
What is the SMILES notation for 4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate?
The canonical SMILES for 4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate is CCOC(=O)C/C(=N\Sc1ccc([N+](=O)[O-])cc1)C(=O)OC.
What is the InChIKey of 4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate?
The InChIKey is JCAREHFLONDKBE-SDNWHVSQSA-N. The full InChI is InChI=1S/C13H14N2O6S/c1-3-21-12(16)8-11(13(17)20-2)14-22-10-6-4-9(5-7-10)15(18)19/h4-7H,3,8H2,1-2H3/b14-11+.
What are the key properties of 4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate?
4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate has a molecular weight of 326.33 g/mol, XLogP of 2.17, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-ethyl 1-O-methyl (2E)-2-(4-nitrophenyl)sulfanyliminobutanedioate is sourced from PubChem (CID 134936177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).