C13H22O3 — CID 15441440
1-[(2R,3S,3aR,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl]pentan-1-one (PubChem CID 15441440) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-[(2R,3S,3aR,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl]pentan-1-one.
| Compound Name | 1-[(2R,3S,3aR,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 15441440 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 1-[(2R,3S,3aR,6aR)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-yl]pentan-1-one |
| SMILES | CCCCC(=O)[C@@H]1[C@H](OC)O[C@@H]2CCC[C@H]12 |
| InChI | InChI=1S/C13H22O3/c1-3-4-7-10(14)12-9-6-5-8-11(9)16-13(12)15-2/h9,11-13H,3-8H2,1-2H3/t9-,11+,12+,13+/m0/s1 |
| InChIKey | MLXUNGRVVNVAQQ-WKSBVSIWSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |