C11H18O4 — CID 13401245
1-(2-ethoxyoxolan-3-yl)pentane-1,4-dione (PubChem CID 13401245) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-(2-ethoxyoxolan-3-yl)pentane-1,4-dione.
| Compound Name | 1-(2-ethoxyoxolan-3-yl)pentane-1,4-dione |
|---|---|
| PubChem CID | 13401245 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-(2-ethoxyoxolan-3-yl)pentane-1,4-dione |
| SMILES | CCOC1OCCC1C(=O)CCC(C)=O |
| InChI | InChI=1S/C11H18O4/c1-3-14-11-9(6-7-15-11)10(13)5-4-8(2)12/h9,11H,3-7H2,1-2H3 |
| InChIKey | YJWYWMRNPGOKCV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |