C18H15Br3Cl3N6O3P3 — CID 154415738
4-[[4,6-bis(4-amino-2-bromophenoxy)-2,4,6-trichloro-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]oxy]-3-bromoaniline (PubChem CID 154415738) has the molecular formula C18H15Br3Cl3N6O3P3 and a molecular weight of 802.35 g/mol. Its IUPAC name is 4-[[4,6-bis(4-amino-2-bromophenoxy)-2,4,6-trichloro-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]oxy]-3-bromoaniline.
| Compound Name | 4-[[4,6-bis(4-amino-2-bromophenoxy)-2,4,6-trichloro-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]oxy]-3-bromoaniline |
|---|---|
| PubChem CID | 154415738 |
| Molecular Formula | C18H15Br3Cl3N6O3P3 |
| Molecular Weight | 802.35 g/mol |
| Exact Mass | 797.70 |
| IUPAC Name | 4-[[4,6-bis(4-amino-2-bromophenoxy)-2,4,6-trichloro-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]oxy]-3-bromoaniline |
| SMILES | Nc1ccc(OP2(Cl)=NP(Cl)(Oc3ccc(N)cc3Br)=NP(Cl)(Oc3ccc(N)cc3Br)=N2)c(Br)c1 |
| InChI | InChI=1S/C18H15Br3Cl3N6O3P3/c19-13-7-10(25)1-4-16(13)31-34(22)28-35(23,32-17-5-2-11(26)8-14(17)20)30-36(24,29-34)33-18-6-3-12(27)9-15(18)21/h1-9H,25-27H2 |
| InChIKey | YAEHHFAKKCURLG-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.35 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|