C18H30O8S2 — CID 154417552
6,9-bis(sulfanyl)tetradecane-4,5,8,9-tetracarboxylic acid (PubChem CID 154417552) has the molecular formula C18H30O8S2 and a molecular weight of 438.56 g/mol. Its IUPAC name is 6,9-bis(sulfanyl)tetradecane-4,5,8,9-tetracarboxylic acid.
| Compound Name | 6,9-bis(sulfanyl)tetradecane-4,5,8,9-tetracarboxylic acid |
|---|---|
| PubChem CID | 154417552 |
| Molecular Formula | C18H30O8S2 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 6,9-bis(sulfanyl)tetradecane-4,5,8,9-tetracarboxylic acid |
| SMILES | CCCCC(C(=O)O)C(S)(CCC(S)(C(=O)O)C(CCCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H30O8S2/c1-3-5-7-11(13(19)20)17(27,15(23)24)9-10-18(28,16(25)26)12(14(21)22)8-6-4-2/h11-12,27-28H,3-10H2,1-2H3,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | RZNSDJASEYYBGJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|