C27H28Cl2Ti-2 — CID 154419387
benzhydrylidene(dichloro)titanium;cyclopenta-1,3-diene;2,3-diethylcyclopenta-1,3-diene (PubChem CID 154419387) has the molecular formula C27H28Cl2Ti-2 and a molecular weight of 471.29 g/mol. Its IUPAC name is benzhydrylidene(dichloro)titanium;cyclopenta-1,3-diene;2,3-diethylcyclopenta-1,3-diene.
| Compound Name | benzhydrylidene(dichloro)titanium;cyclopenta-1,3-diene;2,3-diethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 154419387 |
| Molecular Formula | C27H28Cl2Ti-2 |
| Molecular Weight | 471.29 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | benzhydrylidene(dichloro)titanium;cyclopenta-1,3-diene;2,3-diethylcyclopenta-1,3-diene |
| SMILES | CCc1c[cH-]cc1CC.Cl[Ti](Cl)=C(c1ccccc1)c1ccccc1.c1cc[cH-]c1 |
| InChI | InChI=1S/C13H10.C9H13.C5H5.2ClH.Ti/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-3-8-6-5-7-9(8)4-2;1-2-4-5-3-1;;;/h1-10H;5-7H,3-4H2,1-2H3;1-5H;2*1H;/q;2*-1;;;+2/p-2 |
| InChIKey | DXIYKKWKKUCYJW-UHFFFAOYSA-L |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.29 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|