C24H25FN2O — CID 154428613
2-[3-(1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)-1H-indol-5-yl]-1-(3-fluorophenyl)ethanone (PubChem CID 154428613) has the molecular formula C24H25FN2O and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[3-(1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)-1H-indol-5-yl]-1-(3-fluorophenyl)ethanone.
| Compound Name | 2-[3-(1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)-1H-indol-5-yl]-1-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 154428613 |
| Molecular Formula | C24H25FN2O |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-[3-(1,2,3,5,6,7,8,8a-octahydroindolizin-6-yl)-1H-indol-5-yl]-1-(3-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc2[nH]cc(C3CCC4CCCN4C3)c2c1)c1cccc(F)c1 |
| InChI | InChI=1S/C24H25FN2O/c25-19-4-1-3-17(13-19)24(28)12-16-6-9-23-21(11-16)22(14-26-23)18-7-8-20-5-2-10-27(20)15-18/h1,3-4,6,9,11,13-14,18,20,26H,2,5,7-8,10,12,15H2 |
| InChIKey | DAPAXODXTALPKL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |