C27H25NO2 — CID 15442887
(1S,4R,8R)-3,3,4-triphenyl-2-oxa-5-azatricyclo[6.3.0.01,5]undecan-6-one (PubChem CID 15442887) has the molecular formula C27H25NO2 and a molecular weight of 395.50 g/mol. Its IUPAC name is (1S,4R,8R)-3,3,4-triphenyl-2-oxa-5-azatricyclo[6.3.0.01,5]undecan-6-one.
| Compound Name | (1S,4R,8R)-3,3,4-triphenyl-2-oxa-5-azatricyclo[6.3.0.01,5]undecan-6-one |
|---|---|
| PubChem CID | 15442887 |
| Molecular Formula | C27H25NO2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (1S,4R,8R)-3,3,4-triphenyl-2-oxa-5-azatricyclo[6.3.0.01,5]undecan-6-one |
| SMILES | O=C1C[C@H]2CCC[C@]23OC(c2ccccc2)(c2ccccc2)[C@@H](c2ccccc2)N13 |
| InChI | InChI=1S/C27H25NO2/c29-24-19-23-17-10-18-26(23)28(24)25(20-11-4-1-5-12-20)27(30-26,21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16,23,25H,10,17-19H2/t23-,25-,26+/m1/s1 |
| InChIKey | WWAFFCLJCRQHPR-ARMFNRFLSA-N |
| XLogP | 5.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |