About 3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate
3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate (PubChem CID 154429330) has the molecular formula C19H33O4P
and a molecular weight of 356.44 g/mol. Its IUPAC name is 3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate.
Molecular Properties
| Compound Name | 3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate |
| PubChem CID | 154429330 |
| Molecular Formula | C19H33O4P |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate |
| SMILES | CCC(C)(C)c1cc(CCCOP(=O)(O)O)cc(C(C)(C)CC)c1 |
| InChI | InChI=1S/C19H33O4P/c1-7-18(3,4)16-12-15(10-9-11-23-24(20,21)22)13-17(14-16)19(5,6)8-2/h12-14H,7-11H2,1-6H3,(H2,20,21,22) |
| InChIKey | UMMWKVWDMXMUGI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate?
The IUPAC name of 3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate (CID 154429330) is 3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate.
What is the SMILES notation for 3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate?
The canonical SMILES for 3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate is CCC(C)(C)c1cc(CCCOP(=O)(O)O)cc(C(C)(C)CC)c1.
What is the InChIKey of 3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate?
The InChIKey is UMMWKVWDMXMUGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33O4P/c1-7-18(3,4)16-12-15(10-9-11-23-24(20,21)22)13-17(14-16)19(5,6)8-2/h12-14H,7-11H2,1-6H3,(H2,20,21,22).
What are the key properties of 3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate?
3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate has a molecular weight of 356.44 g/mol, XLogP of 5.10, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-bis(2-methylbutan-2-yl)phenyl]propyl dihydrogen phosphate is sourced from PubChem (CID 154429330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).