C18H37NO4Si — CID 154434972
tert-butyl (2R,4R)-2-(1-dimethylsilyloxy-2,2,3-trimethylbutyl)-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 154434972) has the molecular formula C18H37NO4Si and a molecular weight of 359.58 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-(1-dimethylsilyloxy-2,2,3-trimethylbutyl)-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-(1-dimethylsilyloxy-2,2,3-trimethylbutyl)-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154434972 |
| Molecular Formula | C18H37NO4Si |
| Molecular Weight | 359.58 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | tert-butyl (2R,4R)-2-(1-dimethylsilyloxy-2,2,3-trimethylbutyl)-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)C(C)(C)C(O[SiH](C)C)[C@H]1C[C@@H](O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H37NO4Si/c1-12(2)18(6,7)15(23-24(8)9)14-10-13(20)11-19(14)16(21)22-17(3,4)5/h12-15,20,24H,10-11H2,1-9H3/t13-,14-,15?/m1/s1 |
| InChIKey | RETIZWWDLCKQRF-GRKKQISMSA-N |
| XLogP | 3.41 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|