C13H29ClO3Si3 — CID 154440839
2,2-bis(2-methylprop-1-enylsilyloxy)ethoxy-(3-chloropropyl)silane (PubChem CID 154440839) has the molecular formula C13H29ClO3Si3 and a molecular weight of 353.08 g/mol. Its IUPAC name is 2,2-bis(2-methylprop-1-enylsilyloxy)ethoxy-(3-chloropropyl)silane.
| Compound Name | 2,2-bis(2-methylprop-1-enylsilyloxy)ethoxy-(3-chloropropyl)silane |
|---|---|
| PubChem CID | 154440839 |
| Molecular Formula | C13H29ClO3Si3 |
| Molecular Weight | 353.08 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2,2-bis(2-methylprop-1-enylsilyloxy)ethoxy-(3-chloropropyl)silane |
| SMILES | CC(C)=C[SiH2]OC(CO[SiH2]CCCCl)O[SiH2]C=C(C)C |
| InChI | InChI=1S/C13H29ClO3Si3/c1-11(2)9-19-16-13(17-20-10-12(3)4)8-15-18-7-5-6-14/h9-10,13H,5-8,18-20H2,1-4H3 |
| InChIKey | VCECZSPIHINZLU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.08 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|