C8H20O3SSi — CID 154430039
4-(2,2-dimethoxyethoxysilyl)butane-1-thiol (PubChem CID 154430039) has the molecular formula C8H20O3SSi and a molecular weight of 224.40 g/mol. Its IUPAC name is 4-(2,2-dimethoxyethoxysilyl)butane-1-thiol.
| Compound Name | 4-(2,2-dimethoxyethoxysilyl)butane-1-thiol |
|---|---|
| PubChem CID | 154430039 |
| Molecular Formula | C8H20O3SSi |
| Molecular Weight | 224.40 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 4-(2,2-dimethoxyethoxysilyl)butane-1-thiol |
| SMILES | COC(CO[SiH2]CCCCS)OC |
| InChI | InChI=1S/C8H20O3SSi/c1-9-8(10-2)7-11-13-6-4-3-5-12/h8,12H,3-7,13H2,1-2H3 |
| InChIKey | XHAQMECHRHFMLO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|