C33H78N2O12Si4 — CID 172780147
N,N'-bis[3-(4,4-dimethoxybutoxysilyl)propyl]-N,N'-bis(3-trimethoxysilylpropyl)propane-1,3-diamine (PubChem CID 172780147) has the molecular formula C33H78N2O12Si4 and a molecular weight of 807.33 g/mol. Its IUPAC name is N,N'-bis[3-(4,4-dimethoxybutoxysilyl)propyl]-N,N'-bis(3-trimethoxysilylpropyl)propane-1,3-diamine.
| Compound Name | N,N'-bis[3-(4,4-dimethoxybutoxysilyl)propyl]-N,N'-bis(3-trimethoxysilylpropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 172780147 |
| Molecular Formula | C33H78N2O12Si4 |
| Molecular Weight | 807.33 g/mol |
| Exact Mass | 806.46 |
| IUPAC Name | N,N'-bis[3-(4,4-dimethoxybutoxysilyl)propyl]-N,N'-bis(3-trimethoxysilylpropyl)propane-1,3-diamine |
| SMILES | COC(CCCO[SiH2]CCCN(CCCN(CCC[SiH2]OCCCC(OC)OC)CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)OC |
| InChI | InChI=1S/C33H78N2O12Si4/c1-36-32(37-2)18-11-26-46-48-28-14-22-34(24-16-30-50(40-5,41-6)42-7)20-13-21-35(25-17-31-51(43-8,44-9)45-10)23-15-29-49-47-27-12-19-33(38-3)39-4/h32-33H,11-31,48-49H2,1-10H3 |
| InChIKey | ODLZDFKGHILMOT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 117.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|