C14H33NO6Si — CID 142740325
N-(2-ethoxy-2-methoxyethyl)-N-(2-methoxyethyl)-3-trimethoxysilylpropan-1-amine (PubChem CID 142740325) has the molecular formula C14H33NO6Si and a molecular weight of 339.51 g/mol. Its IUPAC name is N-(2-ethoxy-2-methoxyethyl)-N-(2-methoxyethyl)-3-trimethoxysilylpropan-1-amine.
| Compound Name | N-(2-ethoxy-2-methoxyethyl)-N-(2-methoxyethyl)-3-trimethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 142740325 |
| Molecular Formula | C14H33NO6Si |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | N-(2-ethoxy-2-methoxyethyl)-N-(2-methoxyethyl)-3-trimethoxysilylpropan-1-amine |
| SMILES | CCOC(CN(CCC[Si](OC)(OC)OC)CCOC)OC |
| InChI | InChI=1S/C14H33NO6Si/c1-7-21-14(17-3)13-15(10-11-16-2)9-8-12-22(18-4,19-5)20-6/h14H,7-13H2,1-6H3 |
| InChIKey | BJWXKUSKEZQBKC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|