C6H13NO4Si — CID 154365360
2,2-dimethoxyethoxy(isocyanatomethyl)silane (PubChem CID 154365360) has the molecular formula C6H13NO4Si and a molecular weight of 191.26 g/mol. Its IUPAC name is 2,2-dimethoxyethoxy(isocyanatomethyl)silane.
| Compound Name | 2,2-dimethoxyethoxy(isocyanatomethyl)silane |
|---|---|
| PubChem CID | 154365360 |
| Molecular Formula | C6H13NO4Si |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 2,2-dimethoxyethoxy(isocyanatomethyl)silane |
| SMILES | COC(CO[SiH2]CN=C=O)OC |
| InChI | InChI=1S/C6H13NO4Si/c1-9-6(10-2)3-11-12-5-7-4-8/h6H,3,5,12H2,1-2H3 |
| InChIKey | DQKJNMYIIVPNPU-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|