C14H20FeN2O4 — CID 154442383
3-[2-[(2-acetyl-3-hydroxybut-2-enylidene)amino]ethyliminomethyl]-4-hydroxypent-3-en-2-one;iron (PubChem CID 154442383) has the molecular formula C14H20FeN2O4 and a molecular weight of 336.17 g/mol. Its IUPAC name is 3-[2-[(2-acetyl-3-hydroxybut-2-enylidene)amino]ethyliminomethyl]-4-hydroxypent-3-en-2-one;iron.
| Compound Name | 3-[2-[(2-acetyl-3-hydroxybut-2-enylidene)amino]ethyliminomethyl]-4-hydroxypent-3-en-2-one;iron |
|---|---|
| PubChem CID | 154442383 |
| Molecular Formula | C14H20FeN2O4 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 3-[2-[(2-acetyl-3-hydroxybut-2-enylidene)amino]ethyliminomethyl]-4-hydroxypent-3-en-2-one;iron |
| SMILES | CC(=O)C(/C=N/CC/N=C/C(C(C)=O)=C(C)O)=C(C)O.[Fe] |
| InChI | InChI=1S/C14H20N2O4.Fe/c1-9(17)13(10(2)18)7-15-5-6-16-8-14(11(3)19)12(4)20;/h7-8,17,19H,5-6H2,1-4H3;/b13-9?,14-11?,15-7+,16-8+; |
| InChIKey | KWOHPTZPBZJOGP-DELRTOFRSA-N |
| XLogP | 1.97 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|