C24H33N3O6 — CID 135452557
(Z)-3-[[3,5-bis[[(E)-2-acetyl-3-hydroxybut-2-enylidene]amino]cyclohexyl]iminomethyl]-4-hydroxypent-3-en-2-one (PubChem CID 135452557) has the molecular formula C24H33N3O6 and a molecular weight of 459.54 g/mol. Its IUPAC name is (Z)-3-[[3,5-bis[[(E)-2-acetyl-3-hydroxybut-2-enylidene]amino]cyclohexyl]iminomethyl]-4-hydroxypent-3-en-2-one.
| Compound Name | (Z)-3-[[3,5-bis[[(E)-2-acetyl-3-hydroxybut-2-enylidene]amino]cyclohexyl]iminomethyl]-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 135452557 |
| Molecular Formula | C24H33N3O6 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | (Z)-3-[[3,5-bis[[(E)-2-acetyl-3-hydroxybut-2-enylidene]amino]cyclohexyl]iminomethyl]-4-hydroxypent-3-en-2-one |
| SMILES | CC(=O)C(/C=N/C1CC(/N=C/C(C(C)=O)=C(/C)O)CC(/N=C/C(C(C)=O)=C(/C)O)C1)=C(/C)O |
| InChI | InChI=1S/C24H33N3O6/c1-13(28)22(14(2)29)10-25-19-7-20(26-11-23(15(3)30)16(4)31)9-21(8-19)27-12-24(17(5)32)18(6)33/h10-12,19-21,28,30,32H,7-9H2,1-6H3/b22-13-,23-15+,24-17+,25-10+,26-11+,27-12+ |
| InChIKey | KTNHMNXNHGBUJO-KKTMEVNRSA-N |
| XLogP | 3.75 |
| TPSA | 148.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|