C10H11BrN2O3 — CID 135408308
(E)-3-[(4-bromo-5-methyl-1,2-oxazol-3-yl)iminomethyl]-4-hydroxypent-3-en-2-one (PubChem CID 135408308) has the molecular formula C10H11BrN2O3 and a molecular weight of 287.11 g/mol. Its IUPAC name is (E)-3-[(4-bromo-5-methyl-1,2-oxazol-3-yl)iminomethyl]-4-hydroxypent-3-en-2-one.
| Compound Name | (E)-3-[(4-bromo-5-methyl-1,2-oxazol-3-yl)iminomethyl]-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 135408308 |
| Molecular Formula | C10H11BrN2O3 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | (E)-3-[(4-bromo-5-methyl-1,2-oxazol-3-yl)iminomethyl]-4-hydroxypent-3-en-2-one |
| SMILES | CC(=O)C(/C=N/c1noc(C)c1Br)=C(\C)O |
| InChI | InChI=1S/C10H11BrN2O3/c1-5(14)8(6(2)15)4-12-10-9(11)7(3)16-13-10/h4,14H,1-3H3/b8-5+,12-4+ |
| InChIKey | AUVKXWKMNZWQNO-QKXZTIALSA-N |
| XLogP | 2.87 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|