C26H38N2O6 — CID 136864301
cyclopentyl (E)-2-[[(1R,2R)-2-[[(E)-2-cyclopentyloxycarbonyl-3-hydroxybut-2-enylidene]amino]cyclohexyl]iminomethyl]-3-hydroxybut-2-enoate (PubChem CID 136864301) has the molecular formula C26H38N2O6 and a molecular weight of 474.60 g/mol. Its IUPAC name is cyclopentyl (E)-2-[[(1R,2R)-2-[[(E)-2-cyclopentyloxycarbonyl-3-hydroxybut-2-enylidene]amino]cyclohexyl]iminomethyl]-3-hydroxybut-2-enoate.
| Compound Name | cyclopentyl (E)-2-[[(1R,2R)-2-[[(E)-2-cyclopentyloxycarbonyl-3-hydroxybut-2-enylidene]amino]cyclohexyl]iminomethyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 136864301 |
| Molecular Formula | C26H38N2O6 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | cyclopentyl (E)-2-[[(1R,2R)-2-[[(E)-2-cyclopentyloxycarbonyl-3-hydroxybut-2-enylidene]amino]cyclohexyl]iminomethyl]-3-hydroxybut-2-enoate |
| SMILES | C/C(O)=C(/C=N/[C@@H]1CCCC[C@H]1/N=C/C(C(=O)OC1CCCC1)=C(/C)O)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C26H38N2O6/c1-17(29)21(25(31)33-19-9-3-4-10-19)15-27-23-13-7-8-14-24(23)28-16-22(18(2)30)26(32)34-20-11-5-6-12-20/h15-16,19-20,23-24,29-30H,3-14H2,1-2H3/b21-17+,22-18+,27-15+,28-16+/t23-,24-/m1/s1 |
| InChIKey | YGKPJDIYGGQWDV-LVEKAFCLSA-N |
| XLogP | 5.07 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|