C34H40N2O6 — CID 158609760
cyclopentyl 2-[[(1S,2S)-2-[(2-cyclopentyloxycarbonyl-3-hydroxybut-2-enylidene)amino]-1,2-diphenylethyl]iminomethyl]-3-hydroxybut-2-enoate (PubChem CID 158609760) has the molecular formula C34H40N2O6 and a molecular weight of 572.70 g/mol. Its IUPAC name is cyclopentyl 2-[[(1S,2S)-2-[(2-cyclopentyloxycarbonyl-3-hydroxybut-2-enylidene)amino]-1,2-diphenylethyl]iminomethyl]-3-hydroxybut-2-enoate.
| Compound Name | cyclopentyl 2-[[(1S,2S)-2-[(2-cyclopentyloxycarbonyl-3-hydroxybut-2-enylidene)amino]-1,2-diphenylethyl]iminomethyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 158609760 |
| Molecular Formula | C34H40N2O6 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | cyclopentyl 2-[[(1S,2S)-2-[(2-cyclopentyloxycarbonyl-3-hydroxybut-2-enylidene)amino]-1,2-diphenylethyl]iminomethyl]-3-hydroxybut-2-enoate |
| SMILES | CC(O)=C(/C=N/[C@@H](c1ccccc1)[C@@H](/N=C/C(C(=O)OC1CCCC1)=C(C)O)c1ccccc1)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C34H40N2O6/c1-23(37)29(33(39)41-27-17-9-10-18-27)21-35-31(25-13-5-3-6-14-25)32(26-15-7-4-8-16-26)36-22-30(24(2)38)34(40)42-28-19-11-12-20-28/h3-8,13-16,21-22,27-28,31-32,37-38H,9-12,17-20H2,1-2H3/b29-23?,30-24?,35-21+,36-22+/t31-,32-/m0/s1 |
| InChIKey | AECQSLNCQIERHV-GOIMUJGMSA-N |
| XLogP | 7.25 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|