C20H19NO6 — CID 154447229
(3,4-dimethoxyphenyl) 6,7-dimethoxyquinoline-3-carboxylate (PubChem CID 154447229) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl) 6,7-dimethoxyquinoline-3-carboxylate.
| Compound Name | (3,4-dimethoxyphenyl) 6,7-dimethoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 154447229 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (3,4-dimethoxyphenyl) 6,7-dimethoxyquinoline-3-carboxylate |
| SMILES | COc1ccc(OC(=O)c2cnc3cc(OC)c(OC)cc3c2)cc1OC |
| InChI | InChI=1S/C20H19NO6/c1-23-16-6-5-14(9-18(16)25-3)27-20(22)13-7-12-8-17(24-2)19(26-4)10-15(12)21-11-13/h5-11H,1-4H3 |
| InChIKey | RDUCIIVSAVGGNW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|