About 1H-indol-3-yl quinoline-4-carboxylate
1H-indol-3-yl quinoline-4-carboxylate (PubChem CID 154449060) has the molecular formula C18H12N2O2
and a molecular weight of 288.31 g/mol. Its IUPAC name is 1H-indol-3-yl quinoline-4-carboxylate.
Molecular Properties
| Compound Name | 1H-indol-3-yl quinoline-4-carboxylate |
| PubChem CID | 154449060 |
| Molecular Formula | C18H12N2O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1H-indol-3-yl quinoline-4-carboxylate |
| SMILES | O=C(Oc1c[nH]c2ccccc12)c1ccnc2ccccc12 |
| InChI | InChI=1S/C18H12N2O2/c21-18(13-9-10-19-15-7-3-1-5-12(13)15)22-17-11-20-16-8-4-2-6-14(16)17/h1-11,20H |
| InChIKey | RLNALCKQOCQRQV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-indol-3-yl quinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-3-yl quinoline-4-carboxylate?
The IUPAC name of 1H-indol-3-yl quinoline-4-carboxylate (CID 154449060) is 1H-indol-3-yl quinoline-4-carboxylate.
What is the SMILES notation for 1H-indol-3-yl quinoline-4-carboxylate?
The canonical SMILES for 1H-indol-3-yl quinoline-4-carboxylate is O=C(Oc1c[nH]c2ccccc12)c1ccnc2ccccc12.
What is the InChIKey of 1H-indol-3-yl quinoline-4-carboxylate?
The InChIKey is RLNALCKQOCQRQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O2/c21-18(13-9-10-19-15-7-3-1-5-12(13)15)22-17-11-20-16-8-4-2-6-14(16)17/h1-11,20H.
What are the key properties of 1H-indol-3-yl quinoline-4-carboxylate?
1H-indol-3-yl quinoline-4-carboxylate has a molecular weight of 288.31 g/mol, XLogP of 3.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-3-yl quinoline-4-carboxylate is sourced from PubChem (CID 154449060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).