C23H25NO6 — CID 87787345
[2,3,4-trimethoxy-5-(3-methoxypropyl)phenyl] quinoline-4-carboxylate (PubChem CID 87787345) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is [2,3,4-trimethoxy-5-(3-methoxypropyl)phenyl] quinoline-4-carboxylate.
| Compound Name | [2,3,4-trimethoxy-5-(3-methoxypropyl)phenyl] quinoline-4-carboxylate |
|---|---|
| PubChem CID | 87787345 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | [2,3,4-trimethoxy-5-(3-methoxypropyl)phenyl] quinoline-4-carboxylate |
| SMILES | COCCCc1cc(OC(=O)c2ccnc3ccccc23)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C23H25NO6/c1-26-13-7-8-15-14-19(21(28-3)22(29-4)20(15)27-2)30-23(25)17-11-12-24-18-10-6-5-9-16(17)18/h5-6,9-12,14H,7-8,13H2,1-4H3 |
| InChIKey | MFMVGLKVSMKMHD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|